EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N5O13P2 |
| Net Charge | 0 |
| Average Mass | 515.265 |
| Monoisotopic Mass | 515.04546 |
| SMILES | C[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)nc(N)nc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C13H19N5O13P2/c1-4(12(22)23)30-33(26,27)31-32(24,25)28-2-5-7(19)8(20)11(29-5)18-3-15-6-9(18)16-13(14)17-10(6)21/h3-5,7-8,11,19-20H,2H2,1H3,(H,22,23)(H,24,25)(H,26,27)(H3,14,16,17,21)/t4-,5+,7+,8+,11+/m0/s1 |
| InChIKey | JAIRGSHHKMPRGE-LJRSMJOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lactyl-2-diphospho-5'-guanosine (CHEBI:59436) is a carboxyalkyl phosphate (CHEBI:36952) |
| L-lactyl-2-diphospho-5'-guanosine (CHEBI:59436) is a guanosines (CHEBI:24458) |
| L-lactyl-2-diphospho-5'-guanosine (CHEBI:59436) is conjugate acid of L-lactyl-2-diphospho-5'-guanosine(3−) (CHEBI:59435) |
| Incoming Relation(s) |
| L-lactyl-2-diphospho-5'-guanosine(3−) (CHEBI:59435) is conjugate base of L-lactyl-2-diphospho-5'-guanosine (CHEBI:59436) |
| IUPAC Name |
|---|
| 5'-O-[({[(1S)-1-carboxyethoxy](hydroxy)phosphoryl}oxy)(hydroxy)phosphoryl]guanosine |
| Synonyms | Source |
|---|---|
| (2S)-lactyl-2-diphospho-5'-guanosine | ChEBI |
| (S)-lactyl-2-diphospho-5'-guanosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19155 | KEGG COMPOUND |