EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H10Br4O5S |
| Net Charge | 0 |
| Average Mass | 669.967 |
| Monoisotopic Mass | 665.69824 |
| SMILES | O=S1(=O)OC(c2cc(Br)c(O)c(Br)c2)(c2cc(Br)c(O)c(Br)c2)c2ccccc21 |
| InChI | InChI=1S/C19H10Br4O5S/c20-12-5-9(6-13(21)17(12)24)19(10-7-14(22)18(25)15(23)8-10)11-3-1-2-4-16(11)29(26,27)28-19/h1-8,24-25H |
| InChIKey | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. two-colour indicator A colour indicator that possesses a different colour on each side of the transition interval. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromophenol blue (CHEBI:59424) has role acid-base indicator (CHEBI:50407) |
| bromophenol blue (CHEBI:59424) has role dye (CHEBI:37958) |
| bromophenol blue (CHEBI:59424) has role two-colour indicator (CHEBI:50412) |
| bromophenol blue (CHEBI:59424) is a 2,1-benzoxathiole (CHEBI:38087) |
| bromophenol blue (CHEBI:59424) is a arenesulfonate ester (CHEBI:38094) |
| bromophenol blue (CHEBI:59424) is a organobromine compound (CHEBI:37141) |
| bromophenol blue (CHEBI:59424) is a phenols (CHEBI:33853) |
| bromophenol blue (CHEBI:59424) is a sultone (CHEBI:38088) |
| IUPAC Name |
|---|
| 4,4'-(1,1-dioxido-3H-2,1-benzoxathiole-3,3-diyl)bis(2,6-dibromophenol) |
| Synonyms | Source |
|---|---|
| 3',3'',5',5''-tetrabromophenolsulfonephthalein | ChemIDplus |
| 3',3'',5',5''-tetrabromophenolsulfophthalein | ChemIDplus |
| bromophenol blue, sultone form | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:61698 | Beilstein |
| CAS:115-39-9 | ChemIDplus |