EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N4O11 |
| Net Charge | 0 |
| Average Mass | 492.482 |
| Monoisotopic Mass | 492.20676 |
| SMILES | CC(=O)N[C@@H]1[C@@H](O[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](CCC(=O)O)C(N)=O)[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C19H32N4O11/c1-7(17(30)23-10(16(20)29)4-5-12(26)27)21-18(31)8(2)33-15-13(22-9(3)25)19(32)34-11(6-24)14(15)28/h7-8,10-11,13-15,19,24,28,32H,4-6H2,1-3H3,(H2,20,29)(H,21,31)(H,22,25)(H,23,30)(H,26,27)/t7-,8+,10+,11+,13+,14+,15+,19+/m0/s1 |
| InChIKey | BSOQXXWZTUDTEL-ZUYCGGNHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| Application: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muramyl dipeptide (CHEBI:59414) has role immunological adjuvant (CHEBI:50847) |
| muramyl dipeptide (CHEBI:59414) is a glycopeptide (CHEBI:24396) |
| muramyl dipeptide (CHEBI:59414) is conjugate acid of N-acetyl-β-D-muramoyl-L-alanyl-D-isoglutamine(1−) (CHEBI:194491) |
| Incoming Relation(s) |
| N-acetyl-β-D-muramoyl-L-alanyl-D-isoglutamine(1−) (CHEBI:194491) is conjugate base of muramyl dipeptide (CHEBI:59414) |
| Synonyms | Source |
|---|---|
| MDP | SUBMITTER |
| Acetylmuramyl-L-alanyl-D-isoglutamine | SUBMITTER |
| N-acetylmuramyl-L-alanyl-D-isoglutamine | ChEBI |
| Acetylmuramyl-alanyl-isoglutamine | ChemIDplus |
| N2-(N-(N-Acetylmuramoyl)-L-alanyl)-D-α-glutamine | ChemIDplus |
| MurNAc-L-Ala-γ-D-Glu | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5323915 | Beilstein |
| CAS:53678-77-6 | ChemIDplus |