EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N4O5S |
| Net Charge | 0 |
| Average Mass | 306.344 |
| Monoisotopic Mass | 306.09979 |
| SMILES | NC(=O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H18N4O5S/c11-5(10(18)19)1-2-8(16)14-6(4-20)9(17)13-3-7(12)15/h5-6,20H,1-4,11H2,(H2,12,15)(H,13,17)(H,14,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | FBCIXVYKFFJYFT-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathione amide (CHEBI:59399) is a dicarboxylic acid monoamide (CHEBI:35735) |
| glutathione amide (CHEBI:59399) is a glutathione derivative (CHEBI:24337) |
| glutathione amide (CHEBI:59399) is a tripeptide (CHEBI:47923) |
| glutathione amide (CHEBI:59399) is tautomer of glutathione amide zwitterion (CHEBI:59895) |
| Incoming Relation(s) |
| glutathione amide zwitterion (CHEBI:59895) is tautomer of glutathione amide (CHEBI:59399) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-cysteinylglycinamide |
| Synonyms | Source |
|---|---|
| GASH | ChEBI |
| L-γ-glutamyl-L-cysteinylglycine amide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9653842 | Beilstein |
| CAS:82147-51-1 | ChemIDplus |
| Citations |
|---|