EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N4O11 |
| Net Charge | 0 |
| Average Mass | 502.477 |
| Monoisotopic Mass | 502.19111 |
| SMILES | [H]C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(C)=O)C(C)C |
| InChI | InChI=1S/C20H30N4O11/c1-9(2)17(20(35)22-11(8-25)6-15(29)30)24-18(33)12(4-5-14(27)28)23-19(34)13(7-16(31)32)21-10(3)26/h8-9,11-13,17H,4-7H2,1-3H3,(H,21,26)(H,22,35)(H,23,34)(H,24,33)(H,27,28)(H,29,30)(H,31,32)/t11-,12-,13-,17-/m0/s1 |
| InChIKey | UMBVAPCONCILTL-MRHIQRDNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ac-Asp-Glu-Val-Asp-H (CHEBI:59385) has role protease inhibitor (CHEBI:37670) |
| Ac-Asp-Glu-Val-Asp-H (CHEBI:59385) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N-acetyl-L-α-aspartyl-L-α-glutamyl-N-[(2S)-1-carboxy-3-oxopropan-2-yl]-L-valinamide |
| Synonyms | Source |
|---|---|
| N-acetyl-L-α-aspartyl-L-α-glutamyl-N-[(1S)-2-carboxy-1-formylethyl]-L-valinamide | IUPAC |
| Ac-DEVD-CHO | ChEBI |