EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O6 |
| Net Charge | 0 |
| Average Mass | 234.248 |
| Monoisotopic Mass | 234.11034 |
| SMILES | CO[C@@H]1[C@H](OC(C)=O)[C@H](C)O[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C10H18O6/c1-5-7(16-6(2)11)8(13-3)9(14-4)10(12)15-5/h5,7-10,12H,1-4H3/t5-,7+,8+,9-,10+/m0/s1 |
| InChIKey | HDQIKPACOGFNOV-VEFXURFASA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-acetyl-2,3-di-O-methyl-α-L-fucopyranose (CHEBI:59372) has functional parent α-L-fucose (CHEBI:42548) |
| 4-O-acetyl-2,3-di-O-methyl-α-L-fucopyranose (CHEBI:59372) has role epitope (CHEBI:53000) |
| 4-O-acetyl-2,3-di-O-methyl-α-L-fucopyranose (CHEBI:59372) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Names |
|---|
| 4-O-acetyl-2,3-di-O-methyl-α-L-fucopyranose |
| 4-O-acetyl-6-deoxy-2,3-di-O-methyl-α-L-galactopyranose |
| Synonyms | Source |
|---|---|
| 4-Ac-2,3-di-O-Me-α-L-Fuc | ChEBI |
| 4-Ac-2,3-di-O-Me-α-L-Fucp | ChEBI |
| GPL-9I terminal monosaccharide | ChEBI |
| 4-O-acetyl-2,3-di-O-methyl-α-L-fucose | ChEBI |
| Citations |
|---|