EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12BNO4S |
| Net Charge | 0 |
| Average Mass | 193.033 |
| Monoisotopic Mass | 193.05801 |
| SMILES | N[C@@H](CSCCB(O)O)C(=O)O |
| InChI | InChI=1S/C5H12BNO4S/c7-4(5(8)9)3-12-2-1-6(10)11/h4,10-11H,1-3,7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | OTJHLDXXJHAZTN-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2-boronoethyl)-L-cysteine (CHEBI:59346) is a L-cysteine thioether (CHEBI:27532) |
| S-(2-boronoethyl)-L-cysteine (CHEBI:59346) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| S-(2-boronoethyl)-L-cysteine (CHEBI:59346) is a organoboron compound (CHEBI:38278) |
| IUPAC Names |
|---|
| S-[2-(dihydroxyboryl)ethyl]-L-cysteine |
| S-(2-boronoethyl)-L-cysteine |
| (2R)-2-amino-3-{[2-(dihydroxyboryl)ethyl]sulfanyl}propanoic acid |
| (2R)-2-amino-3-{[2-boronoethyl]sulfanyl}propanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-{[2-(dihydroxyboryl)ethyl]thio}propanoic acid | IUPAC |
| (2R)-2-amino-3-{[2-boronoethyl]thio}propanoic acid | IUPAC |
| BEC | ChEBI |
| Citations |
|---|