EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C14H22N2O9)n |
| Net Charge | 0 |
| Average Mass | 362.335 |
| Monoisotopic Mass | 362.13253 |
| SMILES | *O[C@H]1O[C@H](C)[C@@H](NC([H])=O)[C@H](O)[C@@H]1O[C@H]1O[C@H](C)[C@@H](NC([H])=O)[C@H](O)[C@@H]1O* |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brucella sp. O-PS A-antigen (CHEBI:59342) has role antigen (CHEBI:59132) |
| Brucella sp. O-PS A-antigen (CHEBI:59342) is a O-polysaccharide (CHEBI:64637) |
| Brucella sp. O-PS A-antigen (CHEBI:59342) is a aminoglycan (CHEBI:22506) |
| Synonyms | Source |
|---|---|
| Brucella species O-PS A-antigen | ChEBI |
| poly[α-(1→2)-4,6-dideoxy-4-formamido-D-mannopyranose] | ChEBI |
| Citations |
|---|