EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO |
| Net Charge | 0 |
| Average Mass | 177.247 |
| Monoisotopic Mass | 177.11536 |
| SMILES | CNC(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H15NO/c1-8-4-6-10(7-5-8)11(13)9(2)12-3/h4-7,9,12H,1-3H3 |
| InChIKey | YELGFTGWJGBAQU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mephedrone (CHEBI:59331) has functional parent propiophenone (CHEBI:425902) |
| mephedrone (CHEBI:59331) has role environmental contaminant (CHEBI:78298) |
| mephedrone (CHEBI:59331) has role xenobiotic (CHEBI:35703) |
| mephedrone (CHEBI:59331) is a amphetamines (CHEBI:35338) |
| mephedrone (CHEBI:59331) is a aromatic ketone (CHEBI:76224) |
| mephedrone (CHEBI:59331) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-(methylamino)-1-(4-methylphenyl)propan-1-one |
| Synonyms | Source |
|---|---|
| 4-methylephedrone | ChEBI |
| 4-methylmethcathinone | ChEBI |
| 4-MMC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041923 | HMDB |
| Mephedrone | Wikipedia |
| US2012094316 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2717770 | Reaxys |
| CAS:1189805-46-6 | ChemIDplus |
| Citations |
|---|