EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20BrNO |
| Net Charge | 0 |
| Average Mass | 334.257 |
| Monoisotopic Mass | 333.07283 |
| SMILES | CN(C)CCO[C@H](c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrNO/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15/h3-11,17H,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | NUNIWXHYABYXKF-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-bromazine (CHEBI:59301) is a bromazine (CHEBI:59177) |
| (R)-bromazine (CHEBI:59301) is enantiomer of (S)-bromazine (CHEBI:59302) |
| Incoming Relation(s) |
| (S)-bromazine (CHEBI:59302) is enantiomer of (R)-bromazine (CHEBI:59301) |
| IUPAC Name |
|---|
| 2-[(R)-(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine |
| Synonyms | Source |
|---|---|
| (R)-2-(p-bromo-α-phenylbenzyloxy)-N,N-dimethylethylamine | ChEBI |
| (R)-β-(p-bromobenzhydryloxy)ethyldimethylamine | ChEBI |
| (R)-β-dimethylaminoethyl p-bromobenzhydryl ether | ChEBI |
| (R)-bromodiphenhydramine | ChEBI |