EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC1OC[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a121h-1x_1-5]/1/ |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5?/m0/s1 |
| InChIKey | SRBFZHDQGSBBOR-CZBDKTQLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus warneri (ncbitaxon:596319) | - | PubMed (22102576) | Strain: L37603 |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-xylopyranose (CHEBI:59275) is a L-xylose (CHEBI:65328) |
| Incoming Relation(s) |
| methyl L-xylopyranoside (CHEBI:59274) has functional parent L-xylopyranose (CHEBI:59275) |
| α-L-xylopyranose (CHEBI:149357) is a L-xylopyranose (CHEBI:59275) |
| β-L-xylopyranose (CHEBI:43934) is a L-xylopyranose (CHEBI:59275) |
| UniProt Name | Source |
|---|---|
| L-xylopyranose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DB03911 | DrugBank |
| L-xylopyranose | MetaCyc |
| G14001GU | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2324000 | Reaxys |