EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7+ |
| InChIKey | SECPZKHBENQXJG-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmitelaidic acid (CHEBI:59265) is a long-chain fatty acid (CHEBI:15904) |
| palmitelaidic acid (CHEBI:59265) is a monounsaturated fatty acid (CHEBI:25413) |
| IUPAC Name |
|---|
| (9E)-hexadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| trans-9-hexadecenoic acid | ChEBI |
| trans-palmitoleic acid | ChEBI |
| (E)-9-hexadecenoicacid | ChEBI |
| trans-Δ9-hexadecenoic acid | ChEBI |
| (9E)-hexadecenoic acid | ChEBI |
| t-9-hexadecenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725390 | Beilstein |
| CAS:10030-73-6 | ChemIDplus |
| Citations |
|---|