EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N2O2 |
| Net Charge | +1 |
| Average Mass | 161.225 |
| Monoisotopic Mass | 161.12845 |
| SMILES | C[C@@H](C[N+](C)(C)C)OC(N)=O |
| InChI | InChI=1S/C7H16N2O2/c1-6(11-7(8)10)5-9(2,3)4/h6H,5H2,1-4H3,(H-,8,10)/p+1/t6-/m0/s1 |
| InChIKey | NZUPCNDJBJXXRF-LURJTMIESA-O |
| Roles Classification |
|---|
| Biological Role: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-bethanechol (CHEBI:59261) is a bethanechol (CHEBI:3084) |
| (S)-bethanechol (CHEBI:59261) is enantiomer of (R)-bethanechol (CHEBI:59260) |
| Incoming Relation(s) |
| (R)-bethanechol (CHEBI:59260) is enantiomer of (S)-bethanechol (CHEBI:59261) |
| IUPAC Name |
|---|
| (2S)-2-(carbamoyloxy)-N,N,N-trimethylpropan-1-aminium |
| Synonym | Source |
|---|---|
| (S)-carbamoyl-β-methylcholine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB01019 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6890834 | Beilstein |