EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H64O3 |
| Net Charge | 0 |
| Average Mass | 484.850 |
| Monoisotopic Mass | 484.48555 |
| SMILES | CCCCCCCCCCCCCCCCCC[C@H](O)C[C@H](O)CCCC[C@@H](C)[C@H](CC)OC |
| InChI | InChI=1S/C31H64O3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-29(32)27-30(33)26-23-22-24-28(3)31(6-2)34-4/h28-33H,5-27H2,1-4H3/t28-,29+,30-,31+/m1/s1 |
| InChIKey | HLQGVSDAPGNBGG-ITGKQZKFSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phthiocerol A (CHEBI:59240) has role epitope (CHEBI:53000) |
| phthiocerol A (CHEBI:59240) is a glycol (CHEBI:13643) |
| phthiocerol A (CHEBI:59240) is a phthiocerol derivatives (CHEBI:189847) |
| Incoming Relation(s) |
| phenolic phthiocerol (CHEBI:59237) has parent hydride phthiocerol A (CHEBI:59240) |
| IUPAC Name |
|---|
| (3S,4R,9R,11S)-3-methoxy-4-methylnonacosane-9,11-diol |
| Manual Xrefs | Databases |
|---|---|
| LMFA05000692 | LIPID MAPS |
| Citations |
|---|