EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C70H92ClN17O14 |
| Net Charge | 0 |
| Average Mass | 1431.064 |
| Monoisotopic Mass | 1429.66982 |
| SMILES | CC(=O)N[C@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)N[C@H](Cc1cccnc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CCCNC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(N)=O |
| InChI | InChI=1S/C70H92ClN17O14/c1-39(2)31-52(61(94)82-51(15-9-28-77-69(73)74)68(101)88-30-10-16-58(88)67(100)79-40(3)59(72)92)83-60(93)50(14-8-29-78-70(75)102)81-63(96)54(34-43-20-25-49(91)26-21-43)86-66(99)57(38-89)87-65(98)56(36-45-11-7-27-76-37-45)85-64(97)55(33-42-18-23-48(71)24-19-42)84-62(95)53(80-41(4)90)35-44-17-22-46-12-5-6-13-47(46)32-44/h5-7,11-13,17-27,32,37,39-40,50-58,89,91H,8-10,14-16,28-31,33-36,38H2,1-4H3,(H2,72,92)(H,79,100)(H,80,90)(H,81,96)(H,82,94)(H,83,93)(H,84,95)(H,85,97)(H,86,99)(H,87,98)(H4,73,74,77)(H3,75,78,102)/t40-,50-,51+,52+,53-,54+,55-,56-,57+,58+/m1/s1 |
| InChIKey | SBNPWPIBESPSIF-MHWMIDJBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | GnRH antagonist A chemical substance which inhibits the function of gonadotrophin-releasing hormone (GnRH). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. GnRH antagonist A chemical substance which inhibits the function of gonadotrophin-releasing hormone (GnRH). antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cetrorelix (CHEBI:59224) has role antineoplastic agent (CHEBI:35610) |
| cetrorelix (CHEBI:59224) has role antirheumatic drug (CHEBI:35842) |
| cetrorelix (CHEBI:59224) has role GnRH antagonist (CHEBI:59229) |
| cetrorelix (CHEBI:59224) is a oligopeptide (CHEBI:25676) |
| Incoming Relation(s) |
| cetrorelix acetate (CHEBI:31387) has part cetrorelix (CHEBI:59224) |
| IUPAC Name |
|---|
| N-acetyl-3-(naphthalen-2-yl)-D-alanyl-4-chloro-D-phenylalanyl-3-(pyridin-3-yl)-D-alanyl-L-seryl-L-tyrosyl-N5-carbamoyl-D-ornithyl-L-leucyl-L-arginyl-L-prolyl-D-alaninamide |
| INNs | Source |
|---|---|
| cetrorelix | ChemIDplus |
| cetrorelixum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5860649 | Beilstein |
| CAS:120287-85-6 | ChemIDplus |
| Citations |
|---|