EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C58H73N13O21S2 |
| Net Charge | 0 |
| Average Mass | 1352.426 |
| Monoisotopic Mass | 1351.44854 |
| SMILES | [H][C@@](NC(=O)[C@H](Cc1ccc(OS(=O)(=O)O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCC(=O)N1)(C(=O)NCC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C58H73N13O21S2/c1-29(72)49(71-57(87)40(23-31-12-14-33(15-13-31)92-94(89,90)91)68-56(86)43(26-48(78)79)69-52(82)37(16-18-44(59)73)65-51(81)36-17-19-45(74)63-36)58(88)62-28-46(75)64-41(24-32-27-61-35-11-7-6-10-34(32)35)54(84)66-38(20-21-93-2)53(83)70-42(25-47(76)77)55(85)67-39(50(60)80)22-30-8-4-3-5-9-30/h3-15,27,29,36-43,49,61,72H,16-26,28H2,1-2H3,(H2,59,73)(H2,60,80)(H,62,88)(H,63,74)(H,64,75)(H,65,81)(H,66,84)(H,67,85)(H,68,86)(H,69,82)(H,70,83)(H,71,87)(H,76,77)(H,78,79)(H,89,90,91)/t29-,36+,37+,38+,39+,40+,41+,42+,43+,49+/m1/s1 |
| InChIKey | YRALAIOMGQZKOW-HYAOXDFASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceruletide (CHEBI:59219) has role diagnostic agent (CHEBI:33295) |
| ceruletide (CHEBI:59219) has role gastrointestinal drug (CHEBI:55324) |
| ceruletide (CHEBI:59219) is a oligopeptide (CHEBI:25676) |
| Incoming Relation(s) |
| ceruletide diethylamine (CHEBI:59223) has part ceruletide (CHEBI:59219) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-glutaminyl-L-α-aspartyl-O-sulfo-L-tyrosyl-L-threonylglycyl-L-tryptophyl-L-methionyl-L-α-aspartyl-L-phenylalaninamide |
| INNs | Source |
|---|---|
| ceruletida | ChemIDplus |
| ceruletide | ChemIDplus |
| ceruletidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| caerulein | ChemIDplus |
| cerulein | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 579 | DrugCentral |
| Ceruletide | Wikipedia |
| D03442 | KEGG DRUG |
| DB00403 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5422487 | Beilstein |
| CAS:17650-98-5 | ChemIDplus |