EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24N8O7S2 |
| Net Charge | 0 |
| Average Mass | 612.650 |
| Monoisotopic Mass | 612.12094 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)[C@H](NC(=O)c1cnc(C)cc1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H24N8O7S2/c1-11-7-16(35)15(8-26-11)20(36)27-17(12-3-5-14(34)6-4-12)21(37)28-18-22(38)33-19(24(39)40)13(9-41-23(18)33)10-42-25-29-30-31-32(25)2/h3-8,17-18,23,34H,9-10H2,1-2H3,(H,26,35)(H,27,36)(H,28,37)(H,39,40)/t17-,18-,23-/m1/s1 |
| InChIKey | PWAUCHMQEXVFJR-PMAPCBKXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefpiramide (CHEBI:59213) has role antibacterial drug (CHEBI:36047) |
| cefpiramide (CHEBI:59213) is a carboxylic acid (CHEBI:33575) |
| cefpiramide (CHEBI:59213) is a cephalosporin (CHEBI:23066) |
| cefpiramide (CHEBI:59213) is conjugate acid of cefpiramide(1−) (CHEBI:59214) |
| Incoming Relation(s) |
| cefpiramide(1−) (CHEBI:59214) is conjugate base of cefpiramide (CHEBI:59213) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2R)-2-{[(4-hydroxy-6-methylpyridin-3-yl)carbonyl]amino}-2-(4-hydroxyphenyl)acetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-[(2R)-2-{[(4-hydroxy-6-methylpyridin-3-yl)carbonyl]amino}-2-(4-hydroxyphenyl)acetamido]-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefpiramide | ChemIDplus |
| cefpiramido | ChemIDplus |
| cefpiramidum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8179314 | Beilstein |
| CAS:70797-11-4 | ChemIDplus |
| Citations |
|---|