EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H69N11O12S |
| Net Charge | 0 |
| Average Mass | 988.179 |
| Monoisotopic Mass | 987.48479 |
| SMILES | [H][C@@]1([C@@H](C)CC)NC(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)CCCSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O |
| InChI | InChI=1S/C45H69N11O12S/c1-6-25(4)38-44(66)51-28(15-16-34(46)57)40(62)52-31(21-35(47)58)41(63)54-32(23-69-18-8-10-37(60)50-30(42(64)55-38)20-26-11-13-27(68-5)14-12-26)45(67)56-17-7-9-33(56)43(65)53-29(19-24(2)3)39(61)49-22-36(48)59/h11-14,24-25,28-33,38H,6-10,15-23H2,1-5H3,(H2,46,57)(H2,47,58)(H2,48,59)(H,49,61)(H,50,60)(H,51,66)(H,52,62)(H,53,65)(H,54,63)(H,55,64)/t25-,28-,29-,30-,31-,32-,33-,38-/m0/s1 |
| InChIKey | NSTRIRCPWQHTIA-DTRKZRJBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbetocin (CHEBI:59204) has role oxytocic (CHEBI:36063) |
| carbetocin (CHEBI:59204) is a heterodetic cyclic peptide (CHEBI:24533) |
| IUPAC Name |
|---|
| 1-{[(3R,6S,9S,12S,15S)-6-(2-amino-2-oxoethyl)-9-(3-amino-3-oxopropyl)-12-[(2S)-butan-2-yl]-15-(4-methoxybenzyl)-5,8,11,14,17-pentaoxo-1-thia-4,7,10,13,16-pentaazacycloicosan-3-yl]carbonyl}-L-prolyl-L-leucylglycinamide |
| INNs | Source |
|---|---|
| carbetocin | ChemIDplus |
| carbetocino | ChemIDplus |
| carbetocinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-butanoic acid-2-(O-methyl-L-tyrosine)-1-carbaoxytocin | ChEBI |
| 1-butyric acid-2-(3-(p-methoxyphenyl)-L-alanine)oxytocin | ChemIDplus |
| deamino-2-O-methyltyrosine-1-carbaoxytocin | ChEBI |