EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O8 |
| Net Charge | 0 |
| Average Mass | 226.181 |
| Monoisotopic Mass | 226.06887 |
| SMILES | O=C(O)C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[Ax2122h]/1/ |
| InChI | InChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | KWMLJOLKUYYJFJ-GASJEMHNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2ξ)-D-gluco-heptonic acid (CHEBI:59201) is a carbohydrate acid (CHEBI:33720) |
| (2ξ)-D-gluco-heptonic acid (CHEBI:59201) is a monocarboxylic acid (CHEBI:25384) |
| (2ξ)-D-gluco-heptonic acid (CHEBI:59201) is conjugate acid of (2ξ)-D-gluco-heptonate (CHEBI:59200) |
| Incoming Relation(s) |
| (2ξ)-D-gluco-heptonate (CHEBI:59200) is conjugate base of (2ξ)-D-gluco-heptonic acid (CHEBI:59201) |
| IUPAC Name |
|---|
| (2ξ)-D-gluco-heptonic acid |
| Synonyms | Source |
|---|---|
| (2ξ)-D-glycero-D-gulo-heptonic acid | ChEBI |
| (2ξ)-D-glycero-D-ido-heptonic acid | ChEBI |