EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H13Cl2N3O4 |
| Net Charge | 0 |
| Average Mass | 454.269 |
| Monoisotopic Mass | 453.02831 |
| SMILES | O=C(O)c1nc(C(=O)O)c(-c2cnc3c(Cl)cccc23)c1-c1cnc2c(Cl)cccc12 |
| InChI | InChI=1S/C22H13Cl2N3O4/c23-13-5-1-3-9-11(7-25-17(9)13)15-16(20(22(30)31)27-19(15)21(28)29)12-8-26-18-10(12)4-2-6-14(18)24/h1-8,25-27H,(H,28,29)(H,30,31) |
| InChIKey | OAMCCJASDLMTOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichlorochromopyrrolic acid (CHEBI:59196) is a chloroindole (CHEBI:52508) |
| dichlorochromopyrrolic acid (CHEBI:59196) is a pyrroledicarboxylic acid (CHEBI:59197) |
| dichlorochromopyrrolic acid (CHEBI:59196) is conjugate acid of dichlorochromopyrrolate (CHEBI:59198) |
| Incoming Relation(s) |
| dichlorochromopyrrolate (CHEBI:59198) is conjugate base of dichlorochromopyrrolic acid (CHEBI:59196) |
| IUPAC Name |
|---|
| 3,4-bis(7-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9452627 | Beilstein |