EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9ClN2O2 |
| Net Charge | 0 |
| Average Mass | 236.658 |
| Monoisotopic Mass | 236.03526 |
| SMILES | N/C(=C\c1cnc2c(Cl)cccc12)C(=O)O |
| InChI | InChI=1S/C11H9ClN2O2/c12-8-3-1-2-7-6(5-14-10(7)8)4-9(13)11(15)16/h1-5,14H,13H2,(H,15,16)/b9-4- |
| InChIKey | WPILHRVTMVNLNE-WTKPLQERSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-chloro-α,β-didehydrotryptophan (CHEBI:59195) is a 2,3-dehydroamino acid (CHEBI:145326) |
| 7-chloro-α,β-didehydrotryptophan (CHEBI:59195) is tautomer of 2-iminio-3-(7-chloroindol-3-yl)propionate (CHEBI:59194) |
| Incoming Relation(s) |
| 2-iminio-3-(7-chloroindol-3-yl)propionate (CHEBI:59194) is tautomer of 7-chloro-α,β-didehydrotryptophan (CHEBI:59195) |
| IUPAC Name |
|---|
| (2Z)-2-amino-3-(7-chloro-1H-indol-3-yl)acrylic acid |