EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO5 |
| Net Charge | 0 |
| Average Mass | 461.558 |
| Monoisotopic Mass | 461.22022 |
| SMILES | Cc1ccc(C(=O)Oc2ccc([C@@H](O)CNC(C)(C)C)cc2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H31NO5/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21/h6-16,23,29-30H,17H2,1-5H3/t23-/m0/s1 |
| InChIKey | FZGVEKPRDOIXJY-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-bitolterol (CHEBI:59188) is a bitolterol (CHEBI:3133) |
| (R)-bitolterol (CHEBI:59188) is enantiomer of (S)-bitolterol (CHEBI:59189) |
| Incoming Relation(s) |
| (S)-bitolterol (CHEBI:59189) is enantiomer of (R)-bitolterol (CHEBI:59188) |
| IUPAC Name |
|---|
| 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11441874 | Reaxys |