EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6N2O2 |
| Net Charge | 0 |
| Average Mass | 210.192 |
| Monoisotopic Mass | 210.04293 |
| SMILES | O=C1C(=O)c2ncccc2-c2cccnc21 |
| InChI | InChI=1S/C12H6N2O2/c15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h1-6H |
| InChIKey | VLPADTBFADIFKG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phanquone (CHEBI:59141) has parent hydride 4,7-phenanthroline (CHEBI:36419) |
| phanquone (CHEBI:59141) has role antiamoebic agent (CHEBI:171664) |
| phanquone (CHEBI:59141) is a orthoquinones (CHEBI:25622) |
| IUPAC Name |
|---|
| 4,7-phenanthroline-5,6-dione |
| INNs | Source |
|---|---|
| fanquinona | ChemIDplus |
| phanquinonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,7-Phenanthrolene-5,6-quinone | ChemIDplus |
| 4,7-Phenanthroline-5,6-dione | ChEBI |
| C-11925 | ChEMBL |
| Enthohex | ChemIDplus |
| Entobex | ChemIDplus |
| GNF-PF-1759 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3433 | DrugCentral |
| EP1140090 | Patent |
| Phanquinone | Wikipedia |
| US2003055078 | Patent |
| US7030136 | Patent |
| WO0040244 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:160657 | Reaxys |
| Gmelin:365810 | Gmelin |
| CAS:84-12-8 | ChemIDplus |
| Citations |
|---|