EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N4O2S2 |
| Net Charge | 0 |
| Average Mass | 446.642 |
| Monoisotopic Mass | 446.18102 |
| SMILES | CN1CCN(CCCN2c3ccccc3Sc3ccc(S(=O)(=O)N(C)C)cc32)CC1 |
| InChI | InChI=1S/C22H30N4O2S2/c1-23(2)30(27,28)18-9-10-22-20(17-18)26(19-7-4-5-8-21(19)29-22)12-6-11-25-15-13-24(3)14-16-25/h4-5,7-10,17H,6,11-16H2,1-3H3 |
| InChIKey | VZYCZNZBPPHOFY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioproperazine (CHEBI:59120) has role antipsychotic agent (CHEBI:35476) |
| thioproperazine (CHEBI:59120) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| thioproperazine (CHEBI:59120) is a N-alkylpiperazine (CHEBI:46845) |
| thioproperazine (CHEBI:59120) is a N-methylpiperazine (CHEBI:46920) |
| thioproperazine (CHEBI:59120) is a phenothiazines (CHEBI:38093) |
| thioproperazine (CHEBI:59120) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N,N-dimethyl-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine-2-sulfonamide |
| INNs | Source |
|---|---|
| thioproperazine | KEGG DRUG |
| thioproperazinum | DrugBank |
| tioproferazina | DrugBank |
| Synonyms | Source |
|---|---|
| 2-dimethylsulfamido-(10-(3-1-methylpiperazinyl-4)propyl)-phenothiazine | NIST Chemistry WebBook |
| N,N-Dimethyl-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine-2-sulfonamide | NIST Chemistry WebBook |
| N,N-Dimethyl-10-[3-(4-methyl-1-piperazinyl)propyl]phenothiazine-2-sulfonamide | NIST Chemistry WebBook |
| Thioperazine | DrugBank |
| Thioproperazin | DrugBank |
| (Thioproperazine)-2-dimethylsulfamido-(10-(3-1-methylpiperazinyl-4)propyl)-phenothiazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2635 | DrugCentral |
| D08585 | KEGG DRUG |
| DB01622 | DrugBank |
| GB814512 | Patent |
| HMDB0015559 | HMDB |
| LSM-2170 | LINCS |
| Thioproperazine | Wikipedia |
| Citations |
|---|