EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59119 - thiopropazate
| Formula | C23H28ClN3O2S |
| Net Charge | 0 |
| Average Mass | 446.016 |
| Monoisotopic Mass | 445.15908 |
| SMILES | CC(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C23H28ClN3O2S/c1-18(28)29-16-15-26-13-11-25(12-14-26)9-4-10-27-20-5-2-3-6-22(20)30-23-8-7-19(24)17-21(23)27/h2-3,5-8,17H,4,9-16H2,1H3 |
| InChIKey | AIUHRQHVWSUTGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiopropazate (CHEBI:59119) has role dopaminergic antagonist (CHEBI:48561) |
| thiopropazate (CHEBI:59119) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| thiopropazate (CHEBI:59119) is a N-alkylpiperazine (CHEBI:46845) |
| thiopropazate (CHEBI:59119) is a acetate ester (CHEBI:47622) |
| thiopropazate (CHEBI:59119) is a organochlorine compound (CHEBI:36683) |
| thiopropazate (CHEBI:59119) is a phenothiazines (CHEBI:38093) |
| IUPAC Name |
|---|
| 2-{4-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperazin-1-yl}ethyl acetate |
| INNs | Source |
|---|---|
| thiopropazate | KEGG DRUG |
| thiopropazatum | ChemIDplus |
| tiopropazato | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-Acetoxyethyl)-4-(3-(2-chloro-10-phenothiazinyl)propyl)piperazine | ChemIDplus |
| 10-(3-(1-(2-Acetoxyethyl)-4-piperazinyl)propyl)-2-chlorophenothiazine | ChemIDplus |
| 2-Chloro-10-(3-(1-(2-acetoxyethyl)-4-piperazinyl)propyl)phenothiazine | ChemIDplus |
| 4-(3-(2-Chlorophenothiazin-10-yl)propyl)-1-piperazineethanol acetate | NIST Chemistry WebBook |
| N-(beta-Acetoxyethyl)-N'-(gamma-(2'-chloro-10'-phenothiazinyl)propyl)piperazine | ChemIDplus |
| Thiopropazat | ChemIDplus |
| Citations |
|---|