EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2S |
| Net Charge | 0 |
| Average Mass | 310.466 |
| Monoisotopic Mass | 310.15037 |
| SMILES | CN1CCC(CN2c3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C19H22N2S/c1-20-12-10-15(11-13-20)14-21-16-6-2-4-8-18(16)22-19-9-5-3-7-17(19)21/h2-9,15H,10-14H2,1H3 |
| InChIKey | DLAKWHKNGHJWKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pacatal (CHEBI:59117) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| pacatal (CHEBI:59117) has role antiemetic (CHEBI:50919) |
| pacatal (CHEBI:59117) has role sedative (CHEBI:35717) |
| pacatal (CHEBI:59117) is a phenothiazines (CHEBI:38093) |
| pacatal (CHEBI:59117) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 10-[(1-methylpiperidin-4-yl)methyl]-10H-phenothiazine |
| Synonym | Source |
|---|---|
| 10-((1-Methyl-4-piperidyl)methyl)phenothiazine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1139633 | Reaxys |
| CAS:3772-71-2 | ChemIDplus |
| Citations |
|---|