EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | COc1ccccc1OC |
| InChI | InChI=1S/C8H10O2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3 |
| InChIKey | ABDKAPXRBAPSQN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Silene latifolia (ncbitaxon:37657) | - | PubMed (22937972) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| veratrole (CHEBI:59114) has role plant metabolite (CHEBI:76924) |
| veratrole (CHEBI:59114) is a dimethoxybenzene (CHEBI:51681) |
| Incoming Relation(s) |
| 3-heptadecylveratrole (CHEBI:59113) has functional parent veratrole (CHEBI:59114) |
| IUPAC Name |
|---|
| 1,2-dimethoxybenzene |
| Synonyms | Source |
|---|---|
| 2-Dimethoxybenzol | ChemIDplus |
| 2-Methoxyanisole | ChemIDplus |
| Catechol dimethyl ether | ChemIDplus |
| Methyl guaiacol | NIST Chemistry WebBook |
| o-Dimethoxybenzene | ChEBI |
| O,O-Dimethyl catechol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| veratrole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032139 | HMDB |
| Veratrole | Wikipedia |
| Citations |
|---|