EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O2 |
| Net Charge | 0 |
| Average Mass | 320.517 |
| Monoisotopic Mass | 320.27153 |
| SMILES | CCCCCCCCCCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h15,17-18,22-23H,2-14,16H2,1H3 |
| InChIKey | DQTMTQZSOJMZSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-pentadecylcatechol (CHEBI:59111) has role allergen (CHEBI:50904) |
| 3-pentadecylcatechol (CHEBI:59111) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| 3-pentadecylbenzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3-Pentadecyl-benzene-1,2-diol | ChEMBL |
| 3-n-Pentadecylpyrocatechol | ChemIDplus |
| Dihydrorhengol | ChemIDplus |
| Hydroureshiol | ChemIDplus |
| Tetrahydrourushiol | ChemIDplus |
| 3-Pentadecacatechol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1885390 | Beilstein |
| Reaxys:1885390 | Reaxys |
| CAS:492-89-7 | ChemIDplus |
| Citations |
|---|