EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H42O2 |
| Net Charge | 0 |
| Average Mass | 362.598 |
| Monoisotopic Mass | 362.31848 |
| SMILES | CCCCCCCCCCCCCCCc1c(C)c(C)c(C)c(O)c1O |
| InChI | InChI=1S/C24H42O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20(3)19(2)21(4)23(25)24(22)26/h25-26H,5-18H2,1-4H3 |
| InChIKey | LDSXBSAASMZCGN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5,6-trimethyl-3-pentadecylcatechol (CHEBI:59109) has role allergen (CHEBI:50904) |
| 4,5,6-trimethyl-3-pentadecylcatechol (CHEBI:59109) has role hapten (CHEBI:59174) |
| 4,5,6-trimethyl-3-pentadecylcatechol (CHEBI:59109) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| 3,4,5-trimethyl-6-pentadecylbenzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3,4,5-trimethyl-6-pentadecylcatechol | ChEBI |
| 4,5,6-tri-Me-PDC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3062782 | Beilstein |
| CAS:16273-19-1 | ChemIDplus |
| Citations |
|---|