EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O2 |
| Net Charge | 0 |
| Average Mass | 348.571 |
| Monoisotopic Mass | 348.30283 |
| SMILES | CCCCCCCCCCCCCCCc1cc(C)c(C)c(O)c1O |
| InChI | InChI=1S/C23H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-18-19(2)20(3)22(24)23(21)25/h18,24-25H,4-17H2,1-3H3 |
| InChIKey | PICSKMJWWDBMPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dimethyl-3-pentadecylcatechol (CHEBI:59106) has role allergen (CHEBI:50904) |
| 5,6-dimethyl-3-pentadecylcatechol (CHEBI:59106) has role hapten (CHEBI:59174) |
| 5,6-dimethyl-3-pentadecylcatechol (CHEBI:59106) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| 3,4-dimethyl-6-pentadecylbenzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3,4-dimethyl-6-pentadecylcatechol | ChEBI |
| 5,6-di-Me-PDC | ChEBI |
| Citations |
|---|