EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO |
| Net Charge | 0 |
| Average Mass | 145.161 |
| Monoisotopic Mass | 145.05276 |
| SMILES | [H]C(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
| InChIKey | OLNJUISKUQQNIM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aquilaria sinensis (ncbitaxon:210372) | - | PubMed (27128895) | |
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| Enterobacter cloacae (ncbitaxon:550) | - | PubMed (25427277) | |
| Ipomoea batatas (ncbitaxon:4120) | leaf (BTO:0000713) | PubMed (27132824) | |
| Marinomonas sp. (ncbitaxon:28253) | - | PubMed (26939983) | |
| Patrinia villosa (ncbitaxon:183944) | leaf (BTO:0000713) | PubMed (27019553) | |
| Sphagneticola trilobata (ncbitaxon:53737) | whole plant (BTO:0001461) | PubMed (26946839) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-carbaldehyde (CHEBI:28238) has role bacterial metabolite (CHEBI:76969) |
| indole-3-carbaldehyde (CHEBI:28238) has role human xenobiotic metabolite (CHEBI:76967) |
| indole-3-carbaldehyde (CHEBI:28238) has role marine metabolite (CHEBI:76507) |
| indole-3-carbaldehyde (CHEBI:28238) has role plant metabolite (CHEBI:76924) |
| indole-3-carbaldehyde (CHEBI:28238) is a heteroarenecarbaldehyde (CHEBI:49104) |
| indole-3-carbaldehyde (CHEBI:28238) is a indole alkaloid (CHEBI:38958) |
| indole-3-carbaldehyde (CHEBI:28238) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 1H-indole-3-carbaldehyde |
| Synonyms | Source |
|---|---|
| 1H-Indole-3-carboxaldehyde | ChemIDplus |
| 3-Formylindole | ChemIDplus |
| 3-Indolealdehyde | HMDB |
| 3-Indolecarbaldehyde | HMDB |
| 3-Indolecarboxaldehyde | HMDB |
| beta-Indolylaldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| indole-3-carbaldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 9838 | ChemSpider |
| C00000112 | KNApSAcK |
| C08493 | KEGG COMPOUND |
| HMDB0029737 | HMDB |
| I3A | PDBeChem |
| Indole-3-carboxaldehyde | Wikipedia |
| INDOLE-3-CARBOXALDEHYDE | MetaCyc |
| Citations |
|---|