EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28238 - indole-3-carbaldehyde
| Formula | C9H7NO |
| Net Charge | 0 |
| Average Mass | 145.161 |
| Monoisotopic Mass | 145.05276 |
| SMILES | [H]C(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
| InChIKey | OLNJUISKUQQNIM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aquilaria sinensis (ncbitaxon:210372) | - | PubMed (27128895) | |
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| Enterobacter cloacae (ncbitaxon:550) | - | PubMed (25427277) | |
| Ipomoea batatas (ncbitaxon:4120) | leaf (BTO:0000713) | PubMed (27132824) | |
| Marinomonas sp. (ncbitaxon:28253) | - | PubMed (26939983) | |
| Patrinia villosa (ncbitaxon:183944) | leaf (BTO:0000713) | PubMed (27019553) | |
| Sphagneticola trilobata (ncbitaxon:53737) | whole plant (BTO:0001461) | PubMed (26946839) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-carbaldehyde (CHEBI:28238) has role bacterial metabolite (CHEBI:76969) |
| indole-3-carbaldehyde (CHEBI:28238) has role human xenobiotic metabolite (CHEBI:76967) |
| indole-3-carbaldehyde (CHEBI:28238) has role marine metabolite (CHEBI:76507) |
| indole-3-carbaldehyde (CHEBI:28238) has role plant metabolite (CHEBI:76924) |
| indole-3-carbaldehyde (CHEBI:28238) is a heteroarenecarbaldehyde (CHEBI:49104) |
| indole-3-carbaldehyde (CHEBI:28238) is a indole alkaloid (CHEBI:38958) |
| indole-3-carbaldehyde (CHEBI:28238) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 1H-indole-3-carbaldehyde |
| Synonyms | Source |
|---|---|
| 1H-Indole-3-carboxaldehyde | ChemIDplus |
| 3-Formylindole | ChemIDplus |
| 3-Indolealdehyde | HMDB |
| 3-Indolecarbaldehyde | HMDB |
| 3-Indolecarboxaldehyde | HMDB |
| beta-Indolylaldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| indole-3-carbaldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 9838 | ChemSpider |
| C00000112 | KNApSAcK |
| C08493 | KEGG COMPOUND |
| HMDB0029737 | HMDB |
| I3A | PDBeChem |
| Indole-3-carboxaldehyde | Wikipedia |
| INDOLE-3-CARBOXALDEHYDE | MetaCyc |
| Citations |
|---|