EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28F3N3OS |
| Net Charge | 0 |
| Average Mass | 451.558 |
| Monoisotopic Mass | 451.19052 |
| SMILES | OCCN1CCCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C23H28F3N3OS/c24-23(25,26)18-7-8-22-20(17-18)29(19-5-1-2-6-21(19)31-22)12-4-11-27-9-3-10-28(14-13-27)15-16-30/h1-2,5-8,17,30H,3-4,9-16H2 |
| InChIKey | LOHNHQLZFYCAEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homofenazine (CHEBI:59071) has role anxiolytic drug (CHEBI:35474) |
| homofenazine (CHEBI:59071) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| homofenazine (CHEBI:59071) is a diazepine (CHEBI:47918) |
| homofenazine (CHEBI:59071) is a organofluorine compound (CHEBI:37143) |
| homofenazine (CHEBI:59071) is a phenothiazines (CHEBI:38093) |
| IUPAC Name |
|---|
| 2-(4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}-1,4-diazepan-1-yl)ethan-1-ol |
| INN | Source |
|---|---|
| homofenazine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Hexahydro-4-(3-(2-(trifluoromethyl)phenothiazin-10-yl)propyl)-1H-1,4-diazepine-1-ethanol | ChemIDplus |
| Hexahydro-4-(3-(2-(trifluoromethyl)phenothiazin-10-yl)propyl)-1H-1,4-diazepin-1-ethanol | ChemIDplus |
| Homofenazina | ChemIDplus |
| Homofenazinum | ChemIDplus |
| Citations |
|---|