EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO2 |
| Net Charge | 0 |
| Average Mass | 173.171 |
| Monoisotopic Mass | 173.04768 |
| SMILES | [H]C(=Cc1ccccc1C#N)C(=O)O |
| InChI | InChI=1S/C10H7NO2/c11-7-9-4-2-1-3-8(9)5-6-10(12)13/h1-6H,(H,12,13) |
| InChIKey | HQVOPXGNHGTKOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyanocinnamic acid (CHEBI:59069) is a cinnamic acids (CHEBI:23252) |
| 2-cyanocinnamic acid (CHEBI:59069) is conjugate acid of 2-cyanocinnamate (CHEBI:59070) |
| Incoming Relation(s) |
| 2-cyanocinnamate (CHEBI:59070) is conjugate base of 2-cyanocinnamic acid (CHEBI:59069) |
| IUPAC Name |
|---|
| 3-(2-cyanophenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-cyano-cinnamic acid | ChEBI |
| 3-(2-cyanophenyl)acrylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| DE116123 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2614689 | Beilstein |
| Citations |
|---|