EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9ClN4O2S |
| Net Charge | 0 |
| Average Mass | 284.728 |
| Monoisotopic Mass | 284.01347 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C10H9ClN4O2S/c11-9-5-6-10(14-13-9)15-18(16,17)8-3-1-7(12)2-4-8/h1-6H,12H2,(H,14,15) |
| InChIKey | XOXHILFPRYWFOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfachloropyridazine (CHEBI:59057) has role antibacterial drug (CHEBI:36047) |
| sulfachloropyridazine (CHEBI:59057) has role drug allergen (CHEBI:88188) |
| sulfachloropyridazine (CHEBI:59057) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfachloropyridazine (CHEBI:59057) is a organochlorine compound (CHEBI:36683) |
| sulfachloropyridazine (CHEBI:59057) is a pyridazines (CHEBI:37921) |
| sulfachloropyridazine (CHEBI:59057) is a sulfonamide (CHEBI:35358) |
| INNs | Source |
|---|---|
| sulfachlorpyridazine | ChemIDplus |
| sulfachlorpyridazinum | ChemIDplus |
| sulfacloropiridazina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-N-(6-chloro-3-pyridazinyl)benzenesulfonamide | ChEBI |
| 4-amino-N-(6-chloropyridazin-3-yl)benzenesulfonamide | ChEBI |
| N1-(6-Chloro-3-pyridazinyl)sulfanilamide | ChemIDplus |
| SCP | ChEBI |
| sulphachlorpyridazine | ChemIDplus |
| Citations |
|---|