EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H39N7O7 |
| Net Charge | 0 |
| Average Mass | 645.717 |
| Monoisotopic Mass | 645.29110 |
| SMILES | C[n+]1c(-c2ccc(NCCCNC(=O)CN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)O)cc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C33H39N7O7/c1-38-28-16-23(35)6-10-26(28)25-9-5-22(34)15-27(25)33(38)21-3-7-24(8-4-21)36-11-2-12-37-29(41)17-39(18-30(42)43)13-14-40(19-31(44)45)20-32(46)47/h3-10,15-16H,2,11-14,17-20,34H2,1H3,(H6,35,36,37,41,42,43,44,45,46,47) |
| InChIKey | PFGGLNMBUNROLG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EDTA methidiumpropylamide (CHEBI:59056) has role chelator (CHEBI:38161) |
| EDTA methidiumpropylamide (CHEBI:59056) is a phenanthridines (CHEBI:51245) |
| IUPAC Name |
|---|
| [(carboxymethyl){2-[(carboxymethyl){2-[(3-{[4-(3,8-diamino-5-methylphenanthridinium-6-yl)phenyl]amino}propyl)amino]-2-oxoethyl}amino]ethyl}amino]acetate |