EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24BrN3O9 |
| Net Charge | 0 |
| Average Mass | 518.317 |
| Monoisotopic Mass | 517.06959 |
| SMILES | O=C(O)CN(CC(=O)O)C[C@H](Cc1ccc(NC(=O)CBr)cc1)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C19H24BrN3O9/c20-6-15(24)21-13-3-1-12(2-4-13)5-14(23(10-18(29)30)11-19(31)32)7-22(8-16(25)26)9-17(27)28/h1-4,14H,5-11H2,(H,21,24)(H,25,26)(H,27,28)(H,29,30)(H,31,32)/t14-/m0/s1 |
| InChIKey | VOQPQBGCWBEYEV-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-1-(4-bromoacetamidobenzyl)EDTA (CHEBI:59055) has role chelator (CHEBI:38161) |
| (S)-1-(4-bromoacetamidobenzyl)EDTA (CHEBI:59055) is a tetracarboxylic acid (CHEBI:35742) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-{[(2S)-3-{4-[(bromoacetyl)amino]phenyl}propane-1,2-diyl]dinitrilo}tetraacetic acid |
| Synonyms | Source |
|---|---|
| Fe-BABE | SUBMITTER |
| 2-[[(2S)-1-[bis(carboxymethyl)amino]-3-[4-[(2-bromoacetyl)amino]phenyl] propan-2-yl]-(carboxymethyl)amino]acetic acid | ChEBI |
| 1-(para-Bromoacetamidobenzyl)edta | ChemIDplus |
| N-4-(2,3-Bis(bis(carboxymethyl)amino)propyl)phenyl bromoacetamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7236603 | Beilstein |
| CAS:81677-64-7 | ChemIDplus |