EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O4 |
| Net Charge | 0 |
| Average Mass | 148.158 |
| Monoisotopic Mass | 148.07356 |
| SMILES | CCOC(C)C(=O)C(O)O |
| InChI | InChI=1S/C6H12O4/c1-3-10-4(2)5(7)6(8)9/h4,6,8-9H,3H2,1-2H3 |
| InChIKey | YRCRRHNVYVFNTM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-dihydroxy-3-ethoxy-2-butanone (CHEBI:59052) has role antiinfective agent (CHEBI:35441) |
| 1,1-dihydroxy-3-ethoxy-2-butanone (CHEBI:59052) is a aldehyde hydrate (CHEBI:63733) |
| 1,1-dihydroxy-3-ethoxy-2-butanone (CHEBI:59052) is a butanone (CHEBI:22951) |
| IUPAC Name |
|---|
| 3-ethoxy-1,1-dihydroxybutan-2-one |
| INNs | Source |
|---|---|
| kethoxal | SUBMITTER |
| ketoxalum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-Ethoxy-1,1-dihydroxy-2-butanone | ChemIDplus |
| beta-Ethoxy-alpha-ketobutyraldehyde | ChemIDplus |
| Chetossale | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8677948 | Beilstein |
| CAS:27762-78-3 | KEGG DRUG |
| CAS:27762-78-3 | ChemIDplus |