EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N4O10 |
| Net Charge | 0 |
| Average Mass | 602.641 |
| Monoisotopic Mass | 602.25879 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCNCCCC[C@H](N)C(=O)O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C29H38N4O10/c1-28(42)13-7-6-9-17(34)18(13)22(35)19-14(28)11-15-21(33(2)3)23(36)20(25(38)29(15,43)24(19)37)26(39)32-12-31-10-5-4-8-16(30)27(40)41/h6-7,9,14-16,21,31,34,36-37,42-43H,4-5,8,10-12,30H2,1-3H3,(H,32,39)(H,40,41)/t14-,15-,16-,21-,28+,29-/m0/s1 |
| InChIKey | AHEVKYYGXVEWNO-UEPZRUIBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lymecycline (CHEBI:59040) has role antibacterial drug (CHEBI:36047) |
| lymecycline (CHEBI:59040) has role antimicrobial agent (CHEBI:33281) |
| lymecycline (CHEBI:59040) has role antiprotozoal drug (CHEBI:35820) |
| lymecycline (CHEBI:59040) has role protein synthesis inhibitor (CHEBI:48001) |
| lymecycline (CHEBI:59040) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| lymecycline (CHEBI:59040) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| N6-[({[(4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracen-2-yl]carbonyl}amino)methyl]-L-lysine |
| INNs | Source |
|---|---|
| limeciclina | ChemIDplus |
| lymecycline | KEGG DRUG |
| lymecyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-N-(5-Amino-5-carboxypentylaminomethyl)-4-dimethylamino-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxonaphthacene-2-carboxamide | ChemIDplus |
| N6-((4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamido)methyl)lysine | ChemIDplus |
| N-Lysinomethyltetracycline | ChemIDplus |
| N2-(((+)-5-Amino-5-carboxypentylamino)methyl)tetracycline | ChemIDplus |
| Tetracycline-L-methylene lysine | ChemIDplus |
| Tetracycline-L-methylenelysine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1619 | DrugCentral |
| D06884 | KEGG DRUG |
| DB00256 | DrugBank |
| Lymecycline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15428429 | Reaxys |
| CAS:992-21-2 | KEGG DRUG |
| CAS:992-21-2 | ChemIDplus |
| Citations |
|---|