EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N4O10 |
| Net Charge | 0 |
| Average Mass | 602.641 |
| Monoisotopic Mass | 602.25879 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCNCCCC[C@H](N)C(=O)O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C29H38N4O10/c1-28(42)13-7-6-9-17(34)18(13)22(35)19-14(28)11-15-21(33(2)3)23(36)20(25(38)29(15,43)24(19)37)26(39)32-12-31-10-5-4-8-16(30)27(40)41/h6-7,9,14-16,21,31,34,36-37,42-43H,4-5,8,10-12,30H2,1-3H3,(H,32,39)(H,40,41)/t14-,15-,16-,21-,28+,29-/m0/s1 |
| InChIKey | AHEVKYYGXVEWNO-UEPZRUIBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lymecycline (CHEBI:59040) has role antibacterial drug (CHEBI:36047) |
| lymecycline (CHEBI:59040) has role antimicrobial agent (CHEBI:33281) |
| lymecycline (CHEBI:59040) has role antiprotozoal drug (CHEBI:35820) |
| lymecycline (CHEBI:59040) has role protein synthesis inhibitor (CHEBI:48001) |
| lymecycline (CHEBI:59040) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| lymecycline (CHEBI:59040) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| N6-[({[(4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracen-2-yl]carbonyl}amino)methyl]-L-lysine |
| INNs | Source |
|---|---|
| limeciclina | ChemIDplus |
| lymecycline | KEGG DRUG |
| lymecyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-N-(5-Amino-5-carboxypentylaminomethyl)-4-dimethylamino-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxonaphthacene-2-carboxamide | ChemIDplus |
| N6-((4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamido)methyl)lysine | ChemIDplus |
| N-Lysinomethyltetracycline | ChemIDplus |
| N2-(((+)-5-Amino-5-carboxypentylamino)methyl)tetracycline | ChemIDplus |
| Tetracycline-L-methylene lysine | ChemIDplus |
| Tetracycline-L-methylenelysine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1619 | DrugCentral |
| D06884 | KEGG DRUG |
| DB00256 | DrugBank |
| Lymecycline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15428429 | Reaxys |
| CAS:992-21-2 | KEGG DRUG |
| CAS:992-21-2 | ChemIDplus |
| Citations |
|---|