EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O3S |
| Net Charge | 0 |
| Average Mass | 369.446 |
| Monoisotopic Mass | 369.11471 |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCc3ccc(N=O)cc3)cccc12 |
| InChI | InChI=1S/C19H19N3O3S/c1-22(2)18-7-3-6-17-16(18)5-4-8-19(17)26(24,25)20-13-14-9-11-15(21-23)12-10-14/h3-12,20H,13H2,1-2H3 |
| InChIKey | XKTQDSMBOPQHOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(dimethylamino)-N-(4-nitrosobenzyl)naphthalene-1-sulfonamide (CHEBI:59035) has role allergen (CHEBI:50904) |
| 5-(dimethylamino)-N-(4-nitrosobenzyl)naphthalene-1-sulfonamide (CHEBI:59035) has role hapten (CHEBI:59174) |
| 5-(dimethylamino)-N-(4-nitrosobenzyl)naphthalene-1-sulfonamide (CHEBI:59035) is a nitroso compound (CHEBI:35800) |
| 5-(dimethylamino)-N-(4-nitrosobenzyl)naphthalene-1-sulfonamide (CHEBI:59035) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 5-(dimethylamino)-N-[(4-nitrosophenyl)methyl]naphthalene-1-sulfonamide |
| Synonyms | Source |
|---|---|
| 5-(dimethylamino)-N-(4-nitrosobenzyl)naphthalene-1-sulfonamide | IUPAC |
| DNS-4NSBA | ChEBI |
| DNSBA-NO | ChEBI |
| Citations |
|---|