EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N3O4S.Na |
| Net Charge | 0 |
| Average Mass | 333.345 |
| Monoisotopic Mass | 333.07592 |
| SMILES | Cc1c(N(C)CS(=O)(=O)[O-])c(=O)n(-c2ccccc2)n1C.[Na+] |
| InChI | InChI=1S/C13H17N3O4S.Na/c1-10-12(14(2)9-21(18,19)20)13(17)16(15(10)3)11-7-5-4-6-8-11;/h4-8H,9H2,1-3H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | DJGAAPFSPWAYTJ-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 3 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 3. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. anti-inflammatory agent Any compound that has anti-inflammatory effects. antirheumatic drug A drug used to treat rheumatoid arthritis. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metamizole sodium (CHEBI:59033) has part metamizole(1−) (CHEBI:62086) |
| metamizole sodium (CHEBI:59033) has role anti-inflammatory agent (CHEBI:67079) |
| metamizole sodium (CHEBI:59033) has role antipyretic (CHEBI:35493) |
| metamizole sodium (CHEBI:59033) has role antirheumatic drug (CHEBI:35842) |
| metamizole sodium (CHEBI:59033) has role cyclooxygenase 3 inhibitor (CHEBI:73263) |
| metamizole sodium (CHEBI:59033) has role non-narcotic analgesic (CHEBI:35481) |
| metamizole sodium (CHEBI:59033) has role peripheral nervous system drug (CHEBI:49110) |
| metamizole sodium (CHEBI:59033) has role prodrug (CHEBI:50266) |
| metamizole sodium (CHEBI:59033) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium [(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)(methyl)amino]methanesulfonate |
| INNs | Source |
|---|---|
| meamizol sodico | DrugBank |
| metamizole sodique | DrugBank |
| metamizole sodium | WHO MedNet |
| metamizolum natricum | DrugBank |
| Synonyms | Source |
|---|---|
| Algocalmin | ChemIDplus |
| aminopyrine sodium sulfonate | NIST Chemistry WebBook |
| Analgin | ChemIDplus |
| Analgin (sodium salt) | ChEBI |
| Dipyrone | DrugBank |
| dipyrone [anhydrous] | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Vetalgin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08190 | KEGG DRUG |
| DB04817 | DrugBank |
| Metamizole | Wikipedia |
| Citations |
|---|