EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59030 - oleandrin
| Formula | C32H48O9 |
| Net Charge | 0 |
| Average Mass | 576.727 |
| Monoisotopic Mass | 576.32983 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](C5=CC(=O)OC5)[C@@H](OC(C)=O)C[C@]34O)[C@@]1(C)CC[C@H](O[C@H]1C[C@H](OC)[C@@H](O)[C@H](C)O1)C2 |
| InChI | InChI=1S/C32H48O9/c1-17-29(35)24(37-5)14-27(39-17)41-21-8-10-30(3)20(13-21)6-7-23-22(30)9-11-31(4)28(19-12-26(34)38-16-19)25(40-18(2)33)15-32(23,31)36/h12,17,20-25,27-29,35-36H,6-11,13-16H2,1-5H3/t17-,20+,21-,22-,23+,24-,25-,27-,28-,29-,30-,31+,32-/m0/s1 |
| InChIKey | JLPDBLFIVFSOCC-XYXFTTADSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleandrin (CHEBI:59030) has functional parent oleandrigenin (CHEBI:63508) |
| oleandrin (CHEBI:59030) is a 14β-hydroxy steroid (CHEBI:36862) |
| oleandrin (CHEBI:59030) is a cardenolide glycoside (CHEBI:38092) |
| oleandrin (CHEBI:59030) is a steroid ester (CHEBI:47880) |
| oleandrin (CHEBI:59030) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (3β,5β,16β)-16-acetoxy-3-[(2,6-dideoxy-3-O-methyl-α-L-arabino-hexopyranosyl)oxy]-14-hydroxycard-20(22)-enolide |
| Synonyms | Source |
|---|---|
| Foliandrin | ChemIDplus |
| Folinerin | ChemIDplus |
| Neriolin | ChemIDplus |
| Neriostene | ChemIDplus |
| Oleandrina | ChemIDplus |
| Citations |
|---|