EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O7 |
| Net Charge | 0 |
| Average Mass | 446.540 |
| Monoisotopic Mass | 446.23045 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@](O)(CC[C@]3([H])C3=CC(=O)OC3)[C@]1([H])CC[C@]1(O)C[C@@H](OC(C)=O)CC[C@@]12C=O |
| InChI | InChI=1S/C25H34O7/c1-15(27)32-17-3-8-23(14-26)19-4-7-22(2)18(16-11-21(28)31-13-16)6-10-25(22,30)20(19)5-9-24(23,29)12-17/h11,14,17-20,29-30H,3-10,12-13H2,1-2H3/t17-,18+,19-,20+,22+,23-,24-,25-/m0/s1 |
| InChIKey | JLZAERUVCODZQO-VWCUIIQSSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetylstrophanthidin (CHEBI:59028) has functional parent strophanthidin (CHEBI:38178) |
| acetylstrophanthidin (CHEBI:59028) has role anti-arrhythmia drug (CHEBI:38070) |
| acetylstrophanthidin (CHEBI:59028) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 3β-acetyloxy-5,14-dihydroxy-19-oxo-5β-card-20(22)-enolide |
| Synonyms | Source |
|---|---|
| 3β,5,14-trihydroxy-19-oxo-5β-card-20(22)-enolide 3-acetate | ChemIDplus |
| 3β-acetoxy-5,14-dihydroxy-19-oxo-5β-card-20(22)-enolide | IUPAC |
| Acetyl-k-strophanthidine | ChEBI |
| acetyl-strophanthidin | ChEBI |
| Erysimupicrone acetate | ChemIDplus |
| Strophanthidin 3-acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:99776 | Reaxys |
| CAS:60-38-8 | ChemIDplus |
| Citations |
|---|