EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N |
| Net Charge | 0 |
| Average Mass | 127.231 |
| Monoisotopic Mass | 127.13610 |
| SMILES | CN(C)C1CCCCC1 |
| InChI | InChI=1S/C8H17N/c1-9(2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3 |
| InChIKey | SVYKKECYCPFKGB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylcyclohexylamine (CHEBI:59022) is a tertiary amine (CHEBI:32876) |
| N,N-dimethylcyclohexylamine (CHEBI:59022) is conjugate base of N,N-dimethylcyclohexylaminium (CHEBI:231731) |
| Incoming Relation(s) |
| N,N-dimethylcyclohexylaminium (CHEBI:231731) is conjugate acid of N,N-dimethylcyclohexylamine (CHEBI:59022) |
| IUPAC Name |
|---|
| N,N-dimethylcyclohexanamine |
| Synonyms | Source |
|---|---|
| Cyclohexyldimethylamine | NIST Chemistry WebBook |
| (Dimethylamino)cyclohexane | ChemIDplus |
| Dimethylcyclohexylamine | NIST Chemistry WebBook |
| N-Cyclohexyldimethylamine | ChemIDplus |
| N,N-Dimethylaminocyclohexane | ChemIDplus |
| N,N-Dimethylcyclohexanamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| JP2009040725 | Patent |
| JP2009091278 | Patent |
| US2011112350 | Patent |
| Citations |
|---|