EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O2 |
| Net Charge | 0 |
| Average Mass | 140.182 |
| Monoisotopic Mass | 140.08373 |
| SMILES | C1CC2OC2CC1C1CO1 |
| InChI | InChI=1S/C8H12O2/c1-2-6-7(10-6)3-5(1)8-4-9-8/h5-8H,1-4H2 |
| InChIKey | OECTYKWYRCHAKR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-vinylcyclohexene dioxide (CHEBI:59001) has role carcinogenic agent (CHEBI:50903) |
| 4-vinylcyclohexene dioxide (CHEBI:59001) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| 3-(oxiran-2-yl)-7-oxabicyclo[4.1.0]heptane |
| Synonyms | Source |
|---|---|
| Vinyl cyclohexene dioxide | ChemIDplus |
| 4-Vinyl-1-cyclohexene dioxide | ChemIDplus |
| 1-Epoxyethyl-3,4-epoxycyclohexane | ChemIDplus |
| 1-Ethyleneoxy-3,4-epoxycyclohexane | ChemIDplus |
| 1-Vinyl-3-cyclohexene dioxide | ChemIDplus |
| 3-(1,2-Epoxyethyl)-7-oxabicyclo(4.1.0)heptane | ChemIDplus |
| Citations |
|---|