EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6.H2O |
| Net Charge | 0 |
| Average Mass | 308.286 |
| Monoisotopic Mass | 308.08960 |
| SMILES | O.Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14O6.H2O/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;/h1-5,13,15-20H,6H2;1H2/t13-,15+;/m0./s1 |
| InChIKey | OFUMQWOJBVNKLR-NQQJLSKUSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-catechin monohydrate (CHEBI:58994) has part (+)-catechin (CHEBI:15600) |
| (+)-catechin monohydrate (CHEBI:58994) has role geroprotector (CHEBI:176497) |
| (+)-catechin monohydrate (CHEBI:58994) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (2R,3S)-2-(3,4-dihydroxyphenyl)chromane-3,5,7-triol—water (1/1) |
| Synonyms | Source |
|---|---|
| Catechin hydrate | ChEBI |
| (2R-trans)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol monohydrate | ChemIDplus |
| (+)-catechin hydrate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 97077 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:88191-48-4 | ChemIDplus |
| Citations |
|---|