EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O4 |
| Net Charge | 0 |
| Average Mass | 252.310 |
| Monoisotopic Mass | 252.13616 |
| SMILES | COc1c(C)ccc(CCCCC(=O)O)c1OC |
| InChI | InChI=1S/C14H20O4/c1-10-8-9-11(6-4-5-7-12(15)16)14(18-3)13(10)17-2/h8-9H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | LLBWHJKXNZPCGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid (CHEBI:58992) has functional parent valeric acid (CHEBI:17418) |
| 5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid (CHEBI:58992) is a monocarboxylic acid (CHEBI:25384) |
| 5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid (CHEBI:58992) is conjugate acid of 5-(2,3-dimethoxy-4-methylphenyl)pentanoate (CHEBI:58993) |
| Incoming Relation(s) |
| 5-(2,3-dimethoxy-4-methylphenyl)pentanoate (CHEBI:58993) is conjugate base of 5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid (CHEBI:58992) |
| IUPAC Name |
|---|
| 5-(2,3-dimethoxy-4-methylphenyl)pentanoic acid |
| Synonym | Source |
|---|---|
| 6-methyl catacid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8270029 | Reaxys |
| Citations |
|---|