EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N6O4S.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 666.710 |
| Monoisotopic Mass | 666.23193 |
| SMILES | CCCc1nn(C)c2c(=O)nc(-c3cc(S(=O)(=O)N4CCN(C)CC4)ccc3OCC)nc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H30N6O4S.C6H8O7/c1-5-7-17-19-20(27(4)25-17)22(29)24-21(23-19)16-14-15(8-9-18(16)32-6-2)33(30,31)28-12-10-26(3)11-13-28;7-3(8)1-6(13,5(11)12)2-4(9)10/h8-9,14H,5-7,10-13H2,1-4H3,(H,23,24,29);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | DEIYFTQMQPDXOT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that blocks the action of 3',5'-cyclic-GMP phosphodiesterase (EC 3.1.4.35). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sildenafil citrate (CHEBI:58987) has part sildenafil (CHEBI:9139) |
| sildenafil citrate (CHEBI:58987) has role antihypertensive agent (CHEBI:35674) |
| sildenafil citrate (CHEBI:58987) has role antineoplastic agent (CHEBI:35610) |
| sildenafil citrate (CHEBI:58987) has role antiviral agent (CHEBI:22587) |
| sildenafil citrate (CHEBI:58987) has role cardiovascular drug (CHEBI:35554) |
| sildenafil citrate (CHEBI:58987) has role EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor (CHEBI:71942) |
| sildenafil citrate (CHEBI:58987) has role neuroprotective agent (CHEBI:63726) |
| sildenafil citrate (CHEBI:58987) has role ophthalmology drug (CHEBI:66981) |
| sildenafil citrate (CHEBI:58987) has role vasodilator agent (CHEBI:35620) |
| sildenafil citrate (CHEBI:58987) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| 5-{2-ethoxy-5-[(4-methylpiperazin-1-yl)sulfonyl]phenyl}-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| 1-((3-(6,7-Dihydro-1-methyl-7-oxo-3-propyl-1H-pyrazolo(4,3-d)pyrimidin-5-yl)-4-ethoxyphenyl)sulfonyl)-4-methylpiperazine citrate | ChemIDplus |
| Aphrodil | ChEMBL |
| Liqrev | ChEMBL |
| NSC-744009 | ChEMBL |
| NSC-758669 | ChEMBL |
| Sildenafil (as citrate) | ChEMBL |
| Brand Names | Source |
|---|---|
| Caverta | ChemIDplus |
| Granpidam | ChEMBL |
| Mysildecard | ChEMBL |
| Nipatra | ChEMBL |
| Patrex | ChEMBL |
| Revatio | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02229 | KEGG DRUG |
| DBSALT000347 | DrugBank |
| Sildenafil | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9892846 | Beilstein |
| CAS:171599-83-0 | ChemIDplus |
| CAS:171599-83-0 | KEGG DRUG |
| Citations |
|---|