EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6ClN3 |
| Net Charge | 0 |
| Average Mass | 143.577 |
| Monoisotopic Mass | 143.02502 |
| SMILES | Cc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C5H6ClN3/c1-3-2-4(6)9-5(7)8-3/h2H,1H3,(H2,7,8,9) |
| InChIKey | NPTGVVKPLWFPPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | nitrification inhibitor Any inhibitor added to nitrogen fertilizers which can reduce the rate at which ammonium is converted to nitrate. Under appropriate conditions, this can help reduce nitrogen losses through denitrification and leaching. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-chloro-6-methylpyrimidine (CHEBI:58960) has role nitrification inhibitor (CHEBI:148436) |
| 2-amino-4-chloro-6-methylpyrimidine (CHEBI:58960) is a aminopyrimidine (CHEBI:38338) |
| IUPAC Name |
|---|
| 4-chloro-6-methylpyrimidin-2-amine |
| Synonyms | Source |
|---|---|
| 4-Chloro-6-methylpyrimidin-2-ylamine | ChemIDplus |
| 4-Chloro-6-methyl-2-pyrimidinamine | NIST Chemistry WebBook |
| Citations |
|---|