EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N4O8P2S |
| Net Charge | -2 |
| Average Mass | 466.349 |
| Monoisotopic Mass | 466.04881 |
| SMILES | Cc1ncc(C[n+]2c(C(C)O)sc(CCOP(=O)([O-])OP(=O)([O-])[O-])c2C)c(N)n1 |
| InChI | InChI=1S/C14H22N4O8P2S/c1-8-12(4-5-25-28(23,24)26-27(20,21)22)29-14(9(2)19)18(8)7-11-6-16-10(3)17-13(11)15/h6,9,19H,4-5,7H2,1-3H3,(H4-,15,16,17,20,21,22,23,24)/p-2 |
| InChIKey | RRUVJGASJONMDY-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(1-hydroxyethyl)thiamine diphosphate(2−) (CHEBI:58939) is a organophosphate oxoanion (CHEBI:58945) |
| 2-(1-hydroxyethyl)thiamine diphosphate(2−) (CHEBI:58939) is conjugate base of 2-(1-hydroxyethyl)thiamine diphosphate (CHEBI:978) |
| Incoming Relation(s) |
| 2-(1-hydroxyethyl)thiamine diphosphate (CHEBI:978) is conjugate acid of 2-(1-hydroxyethyl)thiamine diphosphate(2−) (CHEBI:58939) |
| IUPAC Name |
|---|
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(1-hydroxyethyl)-5-(2-diphosphonatoethyl)-4-methyl-1,3-thiazol-3-ium |
| Synonyms | Source |
|---|---|
| 2-(1-hydroxyethyl)thiamine(1+) diphosphate(3−) | ChEBI |
| 2-(1-hydroxyethyl)thiamine diphosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-(1-hydroxyethyl)thiamine diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1660928 | Gmelin |